CymitQuimica logo

CAS 693774-10-6

:

Pyridine, 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
Pyridine, 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, identified by CAS number 693774-10-6, is an organic compound that features a pyridine ring substituted with both methyl groups and a boron-containing moiety. The presence of the pyridine ring imparts basicity and aromatic character to the compound, while the dimethyl substitutions at the 2 and 6 positions enhance its steric properties. The 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl group introduces boron, which can participate in various chemical reactions, particularly in organoboron chemistry, making it useful in synthetic applications. This compound is likely to exhibit moderate solubility in organic solvents and may have specific reactivity patterns due to the presence of both the nitrogen atom in the pyridine and the boron atom in the dioxaborolane. Its unique structure suggests potential applications in medicinal chemistry, materials science, or as a reagent in organic synthesis. However, detailed safety and handling information should be consulted before use.
Formula:C13H20BNO2
InChI:InChI=1S/C13H20BNO2/c1-9-7-8-11(10(2)15-9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3
InChI key:SKHNRJKSLVTZJH-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)C)C
Synonyms:
  • 2,6-Dimethylpyridine-3-boronic acid pinacol ester
Found 5 products.