CAS 6938-27-8

2-methylcyclohexa-2,5-diene-1,4-dione 1-{O-[(3-chlorophenyl)carbonyl]oxime}

Description:

2-Methylcyclohexa-2,5-diene-1,4-dione 1-{O-[(3-chlorophenyl)carbonyl]oxime}, with CAS number 6938-27-8, is a chemical compound characterized by its unique structure that includes a cyclohexadiene core with two ketone functional groups and an oxime derivative. This compound exhibits properties typical of diketones, such as reactivity towards nucleophiles and potential for tautomerization. The presence of the 3-chlorophenyl group enhances its electrophilic character, making it useful in various synthetic applications. The oxime functional group can participate in further chemical reactions, including condensation and rearrangement, which are valuable in organic synthesis. Additionally, the compound may display interesting biological activities, although specific biological data may vary. Its solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the overall molecular conformation. As with many organic compounds, safety precautions should be observed when handling this substance due to potential toxicity or reactivity.

Formula: C₁₄H₁₀ClNO₃

InChI: InChI=1/C14H10ClNO3/c1-9-7-12(17)5-6-13(9)16-19-14(18)10-3-2-4-11(15)8-10/h2-8H,1H3

SMILES: CC1=CC(=O)C=CC1=NOC(=O)c1cccc(c1)Cl

5-nitro-1H-quinolin-2-one

CAS: 6938-27-8

Formula: C₉H₆N₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 190.1555

Ref: IN-DA006F80

5-Nitroquinolin-2(1H)-one

CAS: 6938-27-8

5-Nitroquinolin-2(1H)-one

Purity: 95%

Molecular weight: 190.16g/mol

Ref: 54-OR951924

5-Nitroquinolin-2(1H)-one

CAS: 6938-27-8

Formula: C₉H₆N₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 190.158

Ref: 10-F234122

5-Nitro-1H-quinolin-2-one

Controlled Product

CAS: 6938-27-8

Applications 5-Nitro-1H-quinolin-2-one is used in the synthetic preparation of novel antileishmanial agents for Leishmania donovani promastigotes.
References Paloque, L., et al.: Europ. J. Med. Chem., 54, 75 (2012);

Formula: C₉H₆N₂O₃

Color and Shape: Neat

Molecular weight: 190.16

Ref: TR-N496405

5-Nitro-1H-quinolin-2-one

CAS: 6938-27-8

Versatile small molecule scaffold

Formula: C₉H₆N₂O₃

Purity: Min. 95%

Molecular weight: 190.16 g/mol

Ref: 3D-GAA93827