CymitQuimica logo

CAS 69380-67-2

:

1,2,9,10-Decanetetrol

Description:
1,2,9,10-Decanetetrol, with the CAS number 69380-67-2, is a polyol compound characterized by the presence of four hydroxyl (-OH) functional groups located at the 1, 2, 9, and 10 positions of a decane carbon chain. This structure contributes to its hydrophilic nature, making it soluble in water and other polar solvents. The presence of multiple hydroxyl groups enhances its ability to form hydrogen bonds, which can influence its physical properties, such as boiling point and viscosity. 1,2,9,10-Decanetetrol is typically a colorless, viscous liquid at room temperature and may exhibit a sweet taste. It is used in various applications, including as a building block in organic synthesis, in the formulation of surfactants, and potentially in the production of biodegradable materials. Its unique structure and properties make it a subject of interest in both industrial and research settings, particularly in the development of new materials and chemicals.
Formula:C10H22O4
InChI:InChI=1S/C10H22O4/c11-7-9(13)5-3-1-2-4-6-10(14)8-12/h9-14H,1-8H2
InChI key:InChIKey=DAFWFNCOQYVQDQ-UHFFFAOYSA-N
SMILES:C(CCCCCCC(CO)O)(CO)O
Synonyms:
  • 1,2,9,10-Decanetetrol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.