CAS 693803-17-7
:3-[3-(dihydroxyboranyl)phenyl]propanoic acid
Description:
3-[3-(Dihydroxyboranyl)phenyl]propanoic acid, identified by its CAS number 693803-17-7, is an organic compound featuring a propanoic acid backbone substituted with a phenyl group that contains a dihydroxyboranyl moiety. This compound exhibits characteristics typical of both carboxylic acids and boron-containing compounds. The presence of the carboxylic acid functional group contributes to its acidity and potential for hydrogen bonding, while the dihydroxyboranyl group can participate in coordination chemistry and may enhance the compound's reactivity in various chemical reactions. The boron atom can also influence the compound's solubility and stability in different solvents. Additionally, the phenyl ring provides aromatic stability and can affect the electronic properties of the molecule. Overall, this compound may have applications in organic synthesis, materials science, or medicinal chemistry, particularly in contexts where boron chemistry is advantageous. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods.
Formula:C9H11BO4
InChI:InChI=1/C9H11BO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-3,6,13-14H,4-5H2,(H,11,12)
SMILES:c1cc(CCC(=O)O)cc(c1)B(O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(2-Carboxyethyl)benzeneboronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H11BO4Purity:96%Molecular weight:193.993-(3-Boronophenyl)propanoic acid
CAS:Formula:C9H11BO4Purity:95%Color and Shape:SolidMolecular weight:193.99223-(2-Carboxyethyl)benzeneboronic acid
CAS:3-(2-Carboxyethyl)benzeneboronic acidPurity:98%Molecular weight:193.99g/mol3-(3-Boronophenyl)propanoic acid
CAS:Formula:C9H11BO4Purity:97%Color and Shape:SolidMolecular weight:193.99



