CAS 693806-45-0

[5-bromo-2-(prop-2-yn-1-yloxy)phenyl]methanol

Description:

[5-bromo-2-(prop-2-yn-1-yloxy)phenyl]methanol is an organic compound characterized by its phenolic structure, which includes a bromine substituent and a propargyloxy group. The presence of the bromine atom enhances the compound's reactivity, making it suitable for various chemical transformations, such as nucleophilic substitutions or coupling reactions. The propargyloxy group introduces a triple bond, which can participate in further reactions, including click chemistry or other alkyne-related transformations. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic and aliphatic components, while the hydroxyl group may impart some degree of polarity. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, particularly in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, [5-bromo-2-(prop-2-yn-1-yloxy)phenyl]methanol represents a versatile building block in organic synthesis.

Formula: C₁₀H₉BrO₂

InChI: InChI=1/C10H9BrO2/c1-2-5-13-10-4-3-9(11)6-8(10)7-12/h1,3-4,6,12H,5,7H2

SMILES: C#CCOc1ccc(cc1CO)Br

[5-bromo-2-(2-propyn-1-yloxy)phenyl]methanol

CAS: 693806-45-0

Formula: C₁₀H₉BrO₂

Purity: 95.0%

Color and Shape: Solid, Light yellow powder

Molecular weight: 241.084

Ref: 10-F315498