CAS 693823-10-8

(5-bromo-2-propoxyphenyl)methanol

Description:

(5-bromo-2-propoxyphenyl)methanol is an organic compound characterized by its structure, which includes a bromine atom, a propoxy group, and a hydroxymethyl group attached to a phenyl ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The propoxy group contributes to the compound's hydrophobic characteristics, while the hydroxymethyl group enhances its potential for hydrogen bonding, affecting solubility in polar solvents. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the steric and electronic effects of the substituents on the aromatic ring. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, (5-bromo-2-propoxyphenyl)methanol is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₀H₁₃BrO₂

InChI: InChI=1/C10H13BrO2/c1-2-5-13-10-4-3-9(11)6-8(10)7-12/h3-4,6,12H,2,5,7H2,1H3

SMILES: CCCOc1ccc(cc1CO)Br

(5-Bromo-2-propoxyphenyl)methanol

CAS: 693823-10-8

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrO₂

Purity: Min. 95%

Molecular weight: 245.11 g/mol

Ref: 3D-TCB82310