CAS 69383-59-1
:1-bromo-2,4-dimethyl-5-nitro-benzene
Description:
1-Bromo-2,4-dimethyl-5-nitro-benzene is an aromatic compound characterized by the presence of a bromine atom, two methyl groups, and a nitro group attached to a benzene ring. The bromine substituent typically enhances the compound's reactivity, particularly in electrophilic aromatic substitution reactions. The methyl groups, being electron-donating, can influence the electron density on the aromatic ring, affecting the reactivity and orientation of further substitutions. The nitro group, being electron-withdrawing, can significantly impact the compound's overall electronic properties, making it more susceptible to nucleophilic attack. This compound is likely to be a yellow to brown solid at room temperature, with moderate solubility in organic solvents. Its applications may include use in organic synthesis, as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of the nitro group, which can be toxic and potentially carcinogenic.
Formula:C8H8BrNO2
InChI:InChI=1/C8H8BrNO2/c1-5-3-6(2)8(10(11)12)4-7(5)9/h3-4H,1-2H3
SMILES:Cc1cc(C)c(cc1Br)N(=O)=O
Synonyms:- 5-Bromo-2,4-dimethylnitrobenzene
- Wnr Ce D1 F1 [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-2,4-dimethyl-5-nitrobenzene
CAS:Formula:C8H8BrNO2Purity:97%Color and Shape:SolidMolecular weight:230.05861-Bromo-2,4-dimethyl-5-nitrobenzene
CAS:1-Bromo-2,4-dimethyl-5-nitrobenzeneFormula:C8H8BrNO2Purity:≥95%Color and Shape: mustard powderMolecular weight:230.06g/mol4-Bromo-6-nitro-m-xylene
CAS:4-Bromo-6-nitro-m-xylene is a fine chemical that belongs to the group of reagents and speciality chemicals. It is a versatile building block that can be used as a reaction component or intermediate in the synthesis of complex compounds. 4-Bromo-6-nitro-m-xylene has been shown to react with nucleophiles, such as amines, alcohols, and thiols, to form nitrosamines. This chemical has been used as a research tool for studying the mechanism of action for various drugs. The compound is also useful as a scaffold for other complex compounds.
Formula:C8H8BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:230.06 g/mol1-Bromo-2,4-dimethyl-5-nitrobenzene
CAS:Formula:C8H8BrNO2Purity:98%Color and Shape:SolidMolecular weight:230.061



