CAS 69386-36-3
:2-tert-butyl-9H-carbazole
Description:
2-tert-butyl-9H-carbazole is an organic compound characterized by its structure, which includes a carbazole core with a tert-butyl group attached at the 2-position. This compound is part of the carbazole family, known for their aromatic properties and potential applications in organic electronics, such as light-emitting diodes (OLEDs) and photovoltaic cells. It typically exhibits good thermal stability and solubility in organic solvents, making it suitable for various chemical processes. The presence of the tert-butyl group enhances its steric bulk, which can influence its reactivity and interactions with other molecules. Additionally, 2-tert-butyl-9H-carbazole may exhibit photoluminescent properties, contributing to its utility in optoelectronic applications. Its chemical behavior is influenced by the electron-rich nature of the carbazole moiety, which can participate in various reactions, including electrophilic substitutions. Overall, this compound is of interest in materials science and organic synthesis due to its unique structural features and functional properties.
Formula:C16H17N
InChI:InChI=1/C16H17N/c1-16(2,3)11-8-9-13-12-6-4-5-7-14(12)17-15(13)10-11/h4-10,17H,1-3H3
SMILES:CC(C)(C)c1ccc2c3ccccc3[nH]c2c1
Synonyms:- 9H-carbazole, 2-(1,1-dimethylethyl)-
- 2-tert-Butyl-9H-carbazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
