CAS 6939-13-5

N-propylglycine

Description:

N-Propylglycine, with the CAS number 6939-13-5, is an amino acid derivative characterized by its simple structure, which consists of a propyl group attached to the amino group of glycine. This compound is a colorless to pale yellow liquid or solid, depending on its form and purity. N-Propylglycine is soluble in water and exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding due to its amino and carboxyl functional groups. It is known to act as a neurotransmitter and has been studied for its potential roles in biological systems, particularly in relation to metabolic processes. Additionally, N-propylglycine may exhibit unique biochemical properties that differentiate it from other amino acids, making it of interest in various fields, including biochemistry and pharmacology. Its stability under standard conditions and relatively low toxicity further enhance its appeal for research and potential applications in pharmaceuticals and biotechnology.

Formula: C₅H₁₁NO₂

InChI: InChI=1/C5H11NO2/c1-2-3-6-4-5(7)8/h6H,2-4H2,1H3,(H,7,8)

SMILES: CCCNCC(=O)O

Synonyms:

• (Propylamino)Acetic Acid

2-(Propylamino)acetic acid hydrochloride

CAS: 6939-13-5

Formula: C₅H₁₂ClNO₂

Purity: 98%

Molecular weight: 153.6073

Ref: IN-DA019WAL

2-(Propylamino)acetic acid hydrochloride

CAS: 6939-13-5

2-(Propylamino)acetic acid hydrochloride

Purity: 98%

Molecular weight: 153.61g/mol

Ref: 54-OR77655

2-(Propylamino)acetic acid hydrochloride

CAS: 6939-13-5

Purity: 98%

Molecular weight: 153.6100006

Ref: 10-F664895