CAS 6939-93-1
:4-Bromo-1,3-benzenedicarboxylic acid
Description:
4-Bromo-1,3-benzenedicarboxylic acid, with the CAS number 6939-93-1, is an aromatic compound characterized by the presence of two carboxylic acid groups (-COOH) and a bromine substituent on a benzene ring. This compound features a symmetrical structure, where the bromine atom is positioned at the para position relative to one of the carboxylic acid groups. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional groups. The compound is of interest in organic synthesis and materials science, often serving as a building block for more complex molecules or polymers. Its bromine substituent can enhance reactivity in electrophilic substitution reactions, while the carboxylic acid groups can participate in hydrogen bonding and contribute to the compound's overall acidity. Additionally, 4-bromo-1,3-benzenedicarboxylic acid may exhibit interesting properties such as potential antimicrobial activity or utility in dye synthesis, making it relevant in various chemical research applications.
Formula:C8H5BrO4
InChI:InChI=1S/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=MSQIEZXCNYUWHN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(O)=O)=CC=C1Br
Synonyms:- 1,3-Benzenedicarboxylic acid, 4-bromo-
- 1,3-Dicarboxy-4-bromobenzene
- 1-Bromobenzene-2,4-dicarboxylic acid
- 2-Bromobenzene-1,5-dicarboxylic acid
- 4-Bromo-1,3-benzenedicarboxylic acid
- 4-Bromobenzene-1,3-Dicarboxylate
- 4-Bromobenzene-1,3-dicarboxylic acid
- Isophthalic acid, 4-bromo-
- NSC 38770
- 4-Bromoisophthalic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Bromoisophthalic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H5BrO4Purity:96%Color and Shape:Powder or lumps, WhiteMolecular weight:245.034-Bromoisophthalic Acid
CAS:Formula:C8H5BrO4Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:245.034-Bromoisophthalic acid
CAS:4-Bromoisophthalic acidFormula:C8H5BrO4Purity:98%Color and Shape: white solidMolecular weight:245.03g/mol4-Bromoisophthalic acid
CAS:4-Bromoisophthalic acid is a molecule with a carboxyl group at one end, and a bromine and an isophthalic acid group at the other. It has been shown to bind to the 5-HT7 receptor, which regulates the release of glutamate in neurons and affects the concentration of Ca2+ within cells. 4-Bromoisophthalate inhibits bacterial enzyme carboxylesterase using a mechanism that involves hydrogen bonding interactions. This inhibition prevents the breakdown of 3-mercaptopropionic acid, which would otherwise inhibit Pparγ activation. The structural similarity between 4-bromoisophthalate and xanthinol nicotinate (XNT) was observed by FTIR spectroscopy, allowing for asymmetric synthesis of this molecule.Formula:C8H5BrO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:245.03 g/mol







