
CAS 69393-94-8
:Glyceollin IV
Description:
Glyceollin IV is a phytoalexin, a type of antimicrobial compound produced by plants in response to stress, particularly in soybeans. It is part of a group of compounds known for their potential health benefits, including antioxidant and anti-inflammatory properties. Glyceollin IV is characterized by its complex structure, which includes multiple hydroxyl groups that contribute to its biological activity. This compound has garnered interest in the field of nutraceuticals and functional foods due to its potential role in cancer prevention and treatment, as well as its ability to modulate various biological pathways. Additionally, glyceollins, including Glyceollin IV, have been studied for their effects on metabolic processes and their potential to influence gut health. The compound is typically extracted from soybean plants and may be present in varying concentrations depending on environmental factors and plant maturity. As research continues, the full scope of Glyceollin IV's pharmacological effects and applications in health and disease management is still being explored.
Formula:C21H22O5
InChI:InChI=1S/C21H22O5/c1-12(2)4-5-13-8-15-18(10-17(13)24-3)25-11-21(23)16-7-6-14(22)9-19(16)26-20(15)21/h4,6-10,20,22-23H,5,11H2,1-3H3/t20-,21+/m0/s1
InChI key:InChIKey=WOKIXZBYDPTMJD-LEWJYISDSA-N
SMILES:O[C@]12[C@](C=3C(OC1)=CC(OC)=C(CC=C(C)C)C3)(OC=4C2=CC=C(O)C4)[H]
Synonyms:- 6H-Benzofuro[3,2-c][1]benzopyran-6a,9(11aH)-diol, 3-methoxy-2-(3-methyl-2-butenyl)-, (6aS,11aS)-
- (6aS,11aS)-3-Methoxy-2-(3-methyl-2-buten-1-yl)-6H-benzofuro[3,2-c][1]benzopyran-6a,9(11aH)-diol
- 6H-Benzofuro[3,2-c][1]benzopyran-6a,9(11aH)-diol, 3-methoxy-2-(3-methyl-2-butenyl)-, (6aS-cis)-
- Glyceollin IV
- 6H-Benzofuro[3,2-c][1]benzopyran-6a,9(11aH)-diol, 3-methoxy-2-(3-methyl-2-buten-1-yl)-, (6aS,11aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Glyceollin IV
CAS:Glyceollin IV is a specialized phytoalexin, which is a type of naturally occurring compound produced by plants as a response to stress or pathogen attack, such as soybeans. This compound is derived from the isoflavonoid metabolic pathway and is part of a group of glyceollins known for their bioactive properties. Glyceollin IV operates primarily through mechanisms involving the modulation of cellular stress responses and inhibition of certain enzymatic pathways that contribute to its antimicrobial, antioxidant, and antitumor activities.
Formula:C21H22O5Purity:Min. 95%Molecular weight:354.4 g/mol
