CAS 69394-17-8

Lappaol F

Description:

Lappaol F, with the CAS number 69394-17-8, is a naturally occurring compound primarily derived from the roots of the plant Arctium lappa, commonly known as burdock. This substance belongs to the class of polyphenols and exhibits various biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Lappaol F is characterized by its complex molecular structure, which contributes to its potential therapeutic effects. It has garnered interest in the fields of pharmacology and natural product chemistry due to its potential health benefits. Additionally, Lappaol F may play a role in traditional medicine practices, particularly in Asian cultures, where burdock root is used for its purported health-promoting properties. Research into Lappaol F is ongoing, focusing on its mechanisms of action and potential applications in health and wellness. As with many natural compounds, the specific characteristics, such as solubility and stability, can vary based on environmental conditions and the method of extraction.

Formula: C₄₀H₄₂O₁₂

InChI: InChI=1S/C40H42O12/c1-46-32-15-22(5-7-30(32)43)36-28(17-41)26-11-20(13-34(48-3)38(26)51-36)9-24-19-50-40(45)25(24)10-21-12-27-29(18-42)37(52-39(27)35(14-21)49-4)23-6-8-31(44)33(16-23)47-2/h5-8,11-16,24-25,28-29,36-37,41-44H,9-10,17-19H2,1-4H3/t24-,25+,28-,29-,36+,37+/m0/s1

InChI key: InChIKey=YXNKOCZXAVTXTG-NYGVLQSXSA-N

SMILES: C(O)[C@H]1C=2C(O[C@@H]1C3=CC(OC)=C(O)C=C3)=C(OC)C=C(C[C@@H]4[C@@H](CC=5C=C6C(=C(OC)C5)O[C@@H]([C@H]6CO)C7=CC(OC)=C(O)C=C7)C(=O)OC4)C2

Synonyms:

• 2(3H)-Furanone, 3,4-bis[[(2S,3R)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-5-benzofuranyl]methyl]dihydro-, (3R,4R)-
• (3R,4R)-3,4-Bis[[(2S,3R)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-5-benzofuranyl]methyl]dihydro-2(3H)-furanone
• Lappaol F
• 2(3H)-Furanone, 3,4-bis[[2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-5-benzofuranyl]methyl]dihydro-, [2S-[2α,3β,5[3S*(2R*,3S*),4S*]]]-

Lappaol F

CAS: 69394-17-8

Lappaol F: Antioxidant, anti-aging, promotes longevity, may enhance cancer treatments, inhibits NO in cells.

Formula: C₄₀H₄₂O₁₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 714.75

Ref: TM-TN4411

Lappaol F

CAS: 69394-17-8

Lappaol F is a lignan compound, which is a type of polyphenolic compound found naturally in plants. It is primarily sourced from the roots of the Greater Burdock (Arctium lappa), a plant species well-known for its medicinal properties. Its mode of action involves various biological activities, including antioxidant, anti-inflammatory, and potential anticancer effects. The compound acts by interfering with cellular signaling pathways and promoting apoptosis in cancer cells, making it a compound of interest for cancer research. Additionally, Lappaol F demonstrates potential in modulating inflammatory responses, suggesting applications in treating inflammatory diseases. Its traditional uses in herbal medicine are now being explored through scientific studies to elucidate its mechanisms and broaden its therapeutic applications in modern medicine.

Formula: C₄₀H₄₂O₁₂

Purity: Min. 95%

Molecular weight: 714.80 g/mol

Ref: 3D-UCA39417