CAS 694-31-5

1,5-Dimethylpyrazole

Description:

1,5-Dimethylpyrazole is an organic compound characterized by its pyrazole ring structure, which features two methyl groups attached to the nitrogen atoms at positions 1 and 5. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its stability and relatively low volatility. 1,5-Dimethylpyrazole is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. It is often employed as a ligand in coordination chemistry and as a building block in the synthesis of more complex organic molecules. Additionally, it has applications in agricultural chemistry, particularly as a component in fertilizers and herbicides, due to its ability to influence plant growth and development. The compound's reactivity can be attributed to the presence of the pyrazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, 1,5-Dimethylpyrazole is a versatile compound with significant utility in both research and industrial applications.

Formula: C₅H₈N₂

InChI: InChI=1S/C5H8N2/c1-5-3-4-6-7(5)2/h3-4H,1-2H3

InChI key: InChIKey=LSZQMSSIUQNTDX-UHFFFAOYSA-N

SMILES: CC=1N(C)N=CC1

Synonyms:

• 1,5-Dimethyl-1H-pyrazole
• 1,5-Dimethylpyrazole
• 1H-Pyrazole, 1,5-dimethyl-
• Pyrazole, 1,5-dimethyl-

1,5-Dimethylpyrazole

CAS: 694-31-5

Formula: C₅H₈N₂

Purity: >98.0%(T)

Color and Shape: White - Yellow Liquid

Molecular weight: 96.13

Ref: 3B-D4630

1,5-Dimethyl-1H-pyrazole

CAS: 694-31-5

Formula: C₅H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 96.1304

Ref: IN-DA005M3P

1,5-Dimethyl-1H-pyrazole

CAS: 694-31-5

1,5-Dimethyl-1H-pyrazole

Formula: C₅H₈N₂

Purity: 98%

Color and Shape: clear liquid

Molecular weight: 96.13g/mol

Ref: 54-OR2504

1,5-Dimethyl-1H-pyrazole

CAS: 694-31-5

Formula: C₅H₈N₂

Purity: 97%

Color and Shape: Clear

Molecular weight: 96.133

Ref: 10-F026155

1,5-Dimethylpyrazole

CAS: 694-31-5

1,5-Dimethylpyrazole is a regiospecific gaseous pyrazole. It has been shown to inhibit the reaction of chlorine with hydrochloric acid, which is a major industrial process for the production of chlorinated solvents. 1,5-Dimethylpyrazole also reacts with metal ions and can be used as a catalyst for organic reactions. The molecule can exist in two different isomers, cis-1,5-dimethylpyrazole and trans-1,5-dimethylpyrazole. The data was collected from experiments using plates that were exposed to different concentrations of 1,5-dimethylpyrazole.

Formula: C₅H₈N₂

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 96.13 g/mol

Ref: 3D-FD75461