CAS 694-68-8
:mth-glycine
Description:
Mth-glycine, also known as methylglycine, is an amino acid derivative characterized by its simple structure, which includes an amino group, a carboxyl group, and a methyl group attached to the alpha carbon. Its chemical formula is C2H7NO2, and it is classified as a non-essential amino acid. Methylglycine is a zwitterionic compound, meaning it has both positive and negative charges, which contributes to its solubility in water. It plays a role in various biochemical processes, including acting as a methyl donor in the synthesis of other compounds. Mth-glycine is often found in biological systems and is involved in the metabolism of amino acids and the detoxification of homocysteine. It is generally considered safe and is used in various applications, including dietary supplements and as a potential therapeutic agent in certain medical conditions. Its CAS number, 694-68-8, is used for identification in chemical databases and regulatory contexts.
Formula:C4H6N2OS
InChI:InChI=1/C4H6N2OS/c1-6-3(7)2-5-4(6)8/h2H2,1H3,(H,5,8)
SMILES:CN1C(=O)CN=C1S
Synonyms:- MTH-Glycine Methylthiohydantoin-glycine
- 3-Methyl-2-Thioxoimidazolidin-4-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Methyl-2-thioxoimidazolidin-4-one
CAS:<p>3-Methyl-2-thioxoimidazolidin-4-one</p>Purity:96%Molecular weight:130.17g/mol2-Mercapto-3-methyl-3,5-dihydro-imidazol-4-one
CAS:Formula:C4H6N2OSPurity:98%Color and Shape:SolidMolecular weight:130.172-Mercapto-3-methyl-3,5-dihydro-imidazol-4-one
CAS:<p>2-Mercapto-3-methyl-3,5-dihydro-imidazol-4-one (MMI) is a diagnostic agent that belongs to the group of chemical ionization reagents. It has been shown to be effective as a carcinogen in Sprague Dawley rats and to induce cancer at high doses. MMI is used in the analysis of acidity, and is also used for the analysis of amino acids in proteins by chromatography. MMI reacts with histidine residues on ribosomes and forms an iminium ion, which leads to protein synthesis inhibition. This reaction mechanism can be inhibited by adding an amine such as methylamine or ammonia, thereby inhibiting protein synthesis.</p>Formula:C4H6N2OSPurity:Min. 95%Molecular weight:130.17 g/mol
