CAS 694-87-1
:Benzocyclobutene
Description:
Benzocyclobutene (BCB) is an organic compound characterized by its unique bicyclic structure, which consists of a cyclobutene ring fused to a benzene ring. It is a colorless to pale yellow liquid at room temperature and is known for its low viscosity and high thermal stability. BCB has a relatively high boiling point compared to other hydrocarbons, making it suitable for various applications, particularly in the electronics industry as a dielectric material in semiconductor manufacturing. Its chemical formula is C10H8, and it exhibits properties typical of both aromatic compounds and cycloalkenes, including reactivity in electrophilic aromatic substitution reactions. BCB can undergo polymerization, leading to the formation of cross-linked polymers, which are valuable in producing advanced materials. Additionally, it has a low solubility in water but is soluble in organic solvents, making it versatile for various chemical processes. Due to its unique properties, benzocyclobutene is also studied for its potential applications in photolithography and as a precursor for other chemical syntheses.
Formula:C8H8
InChI:InChI=1/C8H6/c1-2-4-8-6-5-7(8)3-1/h1-6H
InChI key:InChIKey=UMIVXZPTRXBADB-UHFFFAOYSA-N
SMILES:C1=2C(CC1)=CC=CC2
Synonyms:- 1,2-Dihydrobenzocyclobutene
- 1,2-Dihydrocyclobutabenzene
- Benzocyclobutane
- Bicyclo(4.2.0)octa-1,3,5-triene
- Bicyclo[4.2.0]Octa-1,3,5,7-Tetraene
- Bicyclo[4.2.0]octa-2,4,6-triene
- Cardene
- Cyclobutabenzene
- BENZOCYCLOBUTENE
- 1,2-Ethenobenzene
- Benzocyclobutene, 1,2-dihydro-
- 2,3-Vinylenebenzene
- Bicyclo[4.2.0]octa-2,4,6(1)-triene
- 1,2-Vinylenebenzene
- Benzocyclobutadiene
- BICYCLO[4.2.0]OCTA-1,3,5-TRIEN
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzocyclobutene
CAS:Formula:C8H8Purity:>94.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:104.15Bicyclo[4.2.0]octa-1,3,5-triene
CAS:Formula:C8H8Purity:97%Color and Shape:LiquidMolecular weight:104.1491Ref: IN-DA003O21
1kgTo inquire250gTo inquire250mg24.00€1g27.00€5g67.00€10g102.00€25g166.00€50g218.00€100g525.00€Bicyclo[4.2.0]octa-1,3,5-triene
CAS:Bicyclo[4.2.0]octa-1,3,5-trienePurity:98%Molecular weight:104.15g/molBenzocyclobutene
CAS:Benzocyclobutene is a polymer that is insoluble in water and has a low dielectric constant. It is a reactive substance that can undergo polymerization or cross-linking reactions with other substances. Benzocyclobutene can be used as an activation energy source for radiation and thermal expansion, as well as for the production of polymers. The reaction solution can be analyzed gravimetrically to determine the amount of benzocyclobutene present. Magnetic resonance spectroscopy has been used to study the kinetics of benzocyclobutene.Formula:C8H8Purity:Min. 97.5%Color and Shape:Colorless Clear LiquidMolecular weight:104.15 g/molBicyclo[4.2.0]octa-1,3,5-triene
CAS:Formula:C8H8Purity:95%Color and Shape:LiquidMolecular weight:104.152




