CAS 694-92-8
:2-Methylbicyclo[2.2.1]hept-2-ene
Description:
2-Methylbicyclo[2.2.1]hept-2-ene, with the CAS number 694-92-8, is a bicyclic organic compound characterized by its unique structure, which consists of a bicycloheptene framework with a methyl group attached to one of the carbon atoms. This compound features a double bond located within the bicyclic system, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid at room temperature and has a relatively low boiling point, indicating volatility. The presence of the double bond makes it susceptible to electrophilic addition reactions, while the bicyclic structure provides rigidity and stability. 2-Methylbicyclo[2.2.1]hept-2-ene is of interest in the field of synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Its physical and chemical properties, such as solubility and reactivity, can vary depending on the conditions and the presence of other functional groups in a reaction mixture.
Formula:C8H12
InChI:InChI=1S/C8H12/c1-6-4-7-2-3-8(6)5-7/h4,7-8H,2-3,5H2,1H3
InChI key:InChIKey=HTENSGOZPYEMCG-UHFFFAOYSA-N
SMILES:CC=1C2CC(C1)CC2
Synonyms:- 2-Methyl-2-norbornene
- 2-Methylnorbornene
- 2-Norbornene, 2-methyl-
- Bicyclo(2.2.1)hept-2-ene, 2-methyl-
- NSC 135006
- 2-Methylbicyclo[2.2.1]hept-2-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.