CAS 6940-80-3

(2S)-2-(benzylamino)propan-1-ol

Description:

(2S)-2-(Benzylamino)propan-1-ol, with the CAS number 6940-80-3, is an organic compound characterized by its chiral center at the second carbon atom, which contributes to its specific stereochemistry. This compound features a propanol backbone with a benzylamino group, making it an amino alcohol. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both an amino group and a hydroxyl group allows for hydrogen bonding, which can influence its solubility in polar solvents like water and alcohols. Its structure suggests potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active compounds. The compound may exhibit properties such as moderate to high polarity and potential reactivity due to the functional groups present. Additionally, its stereochemistry may play a crucial role in its biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-9(8-12)11-7-10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-/m0/s1

SMILES: C[C@@H](CO)NCc1ccccc1

N-BENZYL-L-ALANINOL

CAS: 6940-80-3

Formula: C₁₀H₁₅NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.2322

Ref: IN-DA005ZRI

(S)-2-(Benzylamino)propan-1-ol

CAS: 6940-80-3

(S)-2-(Benzylamino)propan-1-ol

Purity: 97%

Molecular weight: 165.23g/mol

Ref: 54-OR945737

(S)-2-(Benzylamino)propan-1-ol

Controlled Product

CAS: 6940-80-3

Applications (S)-2-(Benzylamino)propan-1-ol is a useful research chemical for the preparation of cross-benzoin products of heteroaromatic aldehydes and amino aldehydes.
References Haghshenas, P., et al.: J. Org. Chem., 81, 12075-83 (2016);

Formula: C₁₀H₁₅NO

Color and Shape: Neat

Molecular weight: 165.23

Ref: TR-B233873

(S)-2-(Benzylamino)propan-1-ol

CAS: 6940-80-3

Formula: C₁₀H₁₅NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.236

Ref: 10-F239860