CAS 69401-50-9
:3,5,10,12-tetrahydroxy-3-(hydroxyacetyl)-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside
Description:
The chemical substance known as "3,5,10,12-tetrahydroxy-3-(hydroxyacetyl)-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside," with the CAS number 69401-50-9, is a complex organic compound characterized by its polyhydroxylated structure and the presence of both dioxo and amino functional groups. This compound features a tetracene backbone, which is a polycyclic aromatic hydrocarbon, modified with multiple hydroxyl groups that contribute to its solubility and reactivity. The hydroxyacetyl group enhances its potential for further chemical modifications. The presence of the trideoxyhexopyranoside moiety suggests that it may exhibit biological activity, possibly interacting with biological systems or serving as a precursor for glycosylation reactions. Its intricate structure indicates potential applications in pharmaceuticals or biochemistry, particularly in the development of glycosylated compounds. However, specific properties such as solubility, melting point, and reactivity would require empirical investigation to fully characterize its behavior in various environments.
Formula:C26H27NO11
InChI:InChI=1/C26H27NO11/c1-9-21(31)12(27)5-16(37-9)38-14-7-26(36,15(30)8-28)6-11-18(14)25(35)20-19(23(11)33)22(32)10-3-2-4-13(29)17(10)24(20)34/h2-4,9,12,14,16,21,28-29,31,33,35-36H,5-8,27H2,1H3
SMILES:CC1C(C(CC(O1)OC1CC(Cc2c1c(c1c(C(=O)c3cccc(c3C1=O)O)c2O)O)(C(=O)CO)O)N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
14-Hydroxy Carminomycin Oxalate
CAS:Controlled ProductStability Hygroscopic
Applications A semi-synthetic analogue of Carminomycin with cytostatic activity.
References Mossman, T., et al.: J. Immunol. Methods, 65, 55 (1983), Janicke, R.U., et al.: J. Biol. Pharm., 273, 9357 (1998), Sidorova, T.A., et al.: J. Med. Chem., 21, 5330 (2002),Formula:C28H29NO15Color and Shape:NeatMolecular weight:619.53Desmethyl doxorubicin oxalate
CAS:Desmethyl doxorubicin oxalate is an anthracycline-type chemotherapeutic agent, which is derived from the naturally occurring antibiotic doxorubicin. This compound comprises a desmethylated form of doxorubicin combined with oxalate. Its mode of action involves intercalating DNA strands and inhibiting topoisomerase II, thereby disrupting DNA replication and transcription. This interference leads to the inhibition of cancer cell proliferation and induces apoptosis.Formula:C26H27NO11Purity:Min. 95%Molecular weight:529.49 g/mol



