CAS 6941-28-2
:2-methyl-1,3-benzothiazole-6-carboxylic acid
Description:
2-Methyl-1,3-benzothiazole-6-carboxylic acid is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl group at the 2-position of the benzothiazole ring influences its reactivity and solubility. Typically, compounds of this nature exhibit moderate to high polarity due to the carboxylic acid group, which can engage in hydrogen bonding. This substance may be used in various applications, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its unique structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7NO2S
InChI:InChI=1/C9H7NO2S/c1-5-10-7-3-2-6(9(11)12)4-8(7)13-5/h2-4H,1H3,(H,11,12)
SMILES:Cc1nc2ccc(cc2s1)C(=O)O
Synonyms:- 6-Benzothiazolecarboxylic Acid, 2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Methylbenzo[d]thiazole-6-carboxylic acid
CAS:Formula:C9H7NO2SPurity:95%Color and Shape:SolidMolecular weight:193.22242-Methyl-1,3-benzothiazole-6-carboxylic acid
CAS:2-Methyl-1,3-benzothiazole-6-carboxylic acidFormula:C9H7NO2SPurity:95%Color and Shape: light yellow powderMolecular weight:193.22238g/mol2-Methylbenzothiazole-6-carboxylic Acid (~90%)
CAS:Controlled ProductApplications 2-Methylbenzothiazole-6-carboxylic Acid (~90%) is a useful research chemical, a reagent for the synthetic studies on fungicidal agents.
References Saikachi, H., et al.: Yakugaku Zasshi, 78, 376 (1958); Bosco, M., et al.: Annali di Chimica, 58, 1148 (1968)Formula:C9H7NO2SPurity:~90%Color and Shape:NeatMolecular weight:193.222-Methylbenzothiazole-6-carboxylic acid
CAS:Controlled ProductApplications 2-Methylbenzothiazole-6-carboxylic Acid is a useful research chemical, a reagent for the synthetic studies on fungicidal agents.
References Saikachi, H., et al.: Yakugaku Zasshi, 78, 376 (1958)Formula:C9H7NO2SColor and Shape:NeatMolecular weight:193.22




