CAS 69414-08-0
:1,6-dichloro-1,6-dideoxy-D-fructose
Description:
1,6-Dichloro-1,6-dideoxy-D-fructose is a synthetic carbohydrate derivative characterized by the substitution of chlorine atoms at the 1 and 6 positions of the fructose molecule, which is a ketohexose sugar. This compound is notable for its structural modifications that result in the loss of hydroxyl groups at the 1 and 6 positions, leading to its classification as a dideoxy sugar. The presence of chlorine atoms introduces unique chemical properties, including increased hydrophobicity and potential reactivity in various chemical reactions. This compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a substrate for enzymatic reactions. Its applications could extend to research in biochemistry, particularly in studies related to carbohydrate metabolism or the development of glycosylation inhibitors. As with many chlorinated organic compounds, safety considerations regarding toxicity and environmental impact are essential when handling or utilizing this substance in laboratory or industrial settings.
Formula:C6H10Cl2O4
InChI:InChI=1/C6H10Cl2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-6,9,11-12H,1-2H2/t3-,5-,6-/m1/s1
SMILES:C([C@H]([C@H]([C@@H](C(=O)CCl)O)O)O)Cl
Synonyms:- 1,6-Dideoxy-1,6-dichlorofructose
- D-fructose, 1,6-dichloro-1,6-dideoxy-
- 1,6-Dichloro-1,6-dideoxy-D-fructose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,6-Dichloro-1,6-dideoxy-D-fructose
CAS:<p>1,6-Dichloro-1,6-dideoxy-D-fructose (1,6DD) is a synthetic spermicide that prevents the fusion of the egg and sperm. It has been shown to be effective in reducing fertility in male rats. The pharmacological effects of 1,6DD are due to its benzalkonium chloride content. 1,6DD is a reactive chemical that can damage cellular membranes and lead to cell death. Benzalkonium chloride is toxic to human cells and can cause necrosis or apoptosis. The toxicity of 1,6DD on the brain has been demonstrated using human liver cells as well as human brain cells. This agent also has an effect on mineralization and causes an increase in calcium influx into cells by activating calcium channels.</p>Purity:Min. 95%
