CAS 69414-26-2: 4-Methylumbelliferyl α-L-arabinopyranoside
Description:4-Methylumbelliferyl α-L-arabinopyranoside is a synthetic compound commonly used as a substrate in biochemical assays, particularly for the detection of α-L-arabinofuranosidase activity. This compound features a 4-methylumbelliferyl moiety, which is a fluorescent group that emits light upon hydrolysis, making it useful for monitoring enzymatic reactions. The α-L-arabinopyranoside part of the molecule indicates that it is a glycoside, specifically an α-anomer of L-arabinose, which is a five-carbon sugar. The hydrolysis of this compound by specific enzymes releases the fluorescent 4-methylumbelliferone, allowing for quantification and analysis. In terms of solubility, it is generally soluble in water and organic solvents, which facilitates its use in various laboratory settings. The compound is stable under normal laboratory conditions but should be stored properly to maintain its integrity. Overall, 4-Methylumbelliferyl α-L-arabinopyranoside is a valuable tool in enzymology and carbohydrate chemistry for studying glycosidase activities.
Formula:C15H16O7
InChI:InChI=1S/C15H16O7/c1-7-4-12(17)22-11-5-8(2-3-9(7)11)21-15-14(19)13(18)10(16)6-20-15/h2-5,10,13-16,18-19H,6H2,1H3/t10-,13-,14+,15-/m0/s1
InChI key:InChIKey=JWIYLOHVJDJZOQ-HPEDKQMDSA-N
SMILES:O=C1OC=2C=C(OC3OCC(O)C(O)C3O)C=CC2C(=C1)C
- Synonyms:
- 2H-1-Benzopyran-2-one, 7-(α-<span class="text-smallcaps">L</span>-arabinopyranosyloxy)-4-methyl-
- 4-Methylumbelliferyl α-<span class="text-smallcaps">L</span>-arabinopyranoside
- 4-Methylumbelliferyl-ALPHA-L-arabinopyranoside
- 4-methyl-2-oxo-2H-chromen-7-yl pentopyranoside
- 7-(α-<span class="text-smallcaps">L</span>-Arabinopyranosyloxy)-4-methyl-2H-1-benzopyran-2-one
- 4-Methylumbelliferyl α-L-arabinopyranoside
- 2H-1-Benzopyran-2-one, 7-(α-L-arabinopyranosyloxy)-4-methyl-
- 7-(α-L-Arabinopyranosyloxy)-4-methyl-2H-1-benzopyran-2-one
