CAS 6942-46-7

1-Phenylurazole

Description:

1-Phenylurazole, with the CAS number 6942-46-7, is an organic compound that belongs to the class of urazoles, which are characterized by a five-membered ring containing two nitrogen atoms. This compound features a phenyl group attached to the urazole structure, which contributes to its unique chemical properties. 1-Phenylurazole is typically a white to off-white crystalline solid, and it is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The compound exhibits moderate solubility in organic solvents, and its reactivity can be influenced by the presence of the phenyl group, which can participate in electrophilic substitution reactions. Additionally, 1-Phenylurazole may exhibit biological activity, making it of interest for research in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1-Phenylurazole is a compound of interest due to its structural features and potential applications in various chemical contexts.

Formula: C₈H₇N₃O₂

InChI: InChI=1/C8H7N3O2/c12-7-9-8(13)11(10-7)6-4-2-1-3-5-6/h1-5H,(H2,9,10,12,13)

SMILES: c1ccc(cc1)n1c(=O)nc([nH]1)O

Synonyms:

• 1,2,4-Triazolidine-3,5-dione, 1-phenyl-
• 1,2-Hydrazinedicarboxamide, 1-phenyl-
• 1-Phenyl-1,2,4-triazolidine-3,5-dione
• Bicarbamimide, 2-phenyl-

1-Phenyl-1,2,4-triazolidine-3,5-dione

CAS: 6942-46-7

1-Phenyl-1,2,4-triazolidine-3,5-dione is a molecule that can be used for biological purposes. It has the chemical formula of C6H4N2O3 and a molecular weight of 180.14 g/mol. The hydrogen bonds between the hydroxyl group and the skeleton are strong enough to keep the molecule in shape. The molecule is thermally developable; it can be developed after exposure to heat or light. 1-Phenyl-1,2,4-triazolidine-3,5-dione has been shown to react with silver ions and metal surfaces such as aluminum and titanium oxide. This compound may also be useful for coatings that are reactive to light or heat because it will form a film when exposed to either one.

Formula: C₈H₇N₃O₂

Purity: Min. 95%

Molecular weight: 177.16 g/mol

Ref: 3D-GAA94246