CAS 69423-13-8
:2,6-Pyridinedipropanol
Description:
2,6-Pyridinedipropanol, identified by its CAS number 69423-13-8, is an organic compound characterized by its pyridine ring substituted with two propanol groups at the 2 and 6 positions. This compound typically exhibits properties associated with both pyridine and alcohol functional groups, including moderate polarity and potential hydrogen bonding capabilities due to the hydroxyl (-OH) groups. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the pyridine ring suggests that it may have basic properties, while the alcohol groups can impart solubility in polar solvents. 2,6-Pyridinedipropanol may find applications in various fields, including pharmaceuticals, as a potential intermediate in organic synthesis or as a ligand in coordination chemistry. Its reactivity can be influenced by the functional groups present, allowing for diverse chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c13-8-2-6-10-4-1-5-11(12-10)7-3-9-14/h1,4-5,13-14H,2-3,6-9H2
InChI key:InChIKey=GVIZSPVYUCBWKE-UHFFFAOYSA-N
SMILES:C(CCO)C=1N=C(CCCO)C=CC1
Synonyms:- 2,6-Pyridinedipropanol
- 3-[6-(3-Hydroxypropyl)-2-Pyridyl]Propan-1-Ol
- Pyridine-2,6-dipropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
