CAS 69427-80-1

9-(2-amino-2-deoxy-beta-D-arabinofuranosyl)-9H-purin-6-amine

Description:

The chemical substance known as "9-(2-amino-2-deoxy-beta-D-arabinofuranosyl)-9H-purin-6-amine," with the CAS number 69427-80-1, is a nucleoside analog that features a purine base linked to an arabinofuranosyl sugar. This compound is characterized by its structural components, which include a purine ring system and an amino group at the 6-position of the purine, as well as an amino group on the sugar moiety. It is often studied for its potential biological activity, particularly in the context of antiviral and anticancer research, due to its ability to interfere with nucleic acid synthesis. The presence of the 2-amino group on the sugar enhances its solubility and stability in biological systems. Additionally, this compound may exhibit specific interactions with enzymes involved in nucleic acid metabolism, making it a subject of interest in medicinal chemistry. Its unique structure allows for potential modifications that could enhance its therapeutic efficacy or reduce toxicity.

Formula: C₁₀H₁₄N₆O₃

InChI: InChI=1/C10H14N6O3/c11-5-7(18)4(1-17)19-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1,11H2,(H2,12,13,14)/t4-,5+,7-,10-/m1/s1

Adenosine Impurity 1

CAS: 69427-80-1

Formula: C₁₀H₁₄N₆O₃

Molecular weight: 266.26

Ref: 4Z-A-267010

2-Amino-2-deoxy-β-arabinofuranosyladenine

CAS: 69427-80-1

2-Amino-2-deoxy-beta-arabinofuranosyladenine is an impurity standard for the synthesis of 2,6-diaminopurine. It is a synthetic compound that can be used to study metabolism. 2-Amino-2-deoxy-beta-arabinofuranosyladenine is a metabolite of nucleosides and nucleotides. It has been shown to have anti-inflammatory properties in animal models. 2,6-Diaminopurine protects the liver from oxidative stress by modulating glutathione biosynthesis and providing sulfur to the cell.

Formula: C₁₀H₁₄N₆O₃

Purity: Min. 95%

Molecular weight: 266.26 g/mol

Ref: 3D-IA181468