CAS 6943-17-5
:6-nitroquinazolin-4(1H)-one
Description:
6-Nitroquinazolin-4(1H)-one is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. The presence of a nitro group at the 6-position and a carbonyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a yellow crystalline solid and is known for its potential biological activities, including antimicrobial and anticancer properties. It is soluble in organic solvents but may have limited solubility in water. The compound's reactivity can be attributed to the electron-withdrawing nature of the nitro group, which can influence its interactions with other molecules. Additionally, 6-nitroquinazolin-4(1H)-one can serve as a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as with many nitro compounds, it may pose health risks if not managed properly. Overall, its structural features and biological relevance make it a compound of interest in medicinal chemistry and drug development.
Formula:C8H5N3O3
InChI:InChI=1/C8H5N3O3/c12-8-6-3-5(11(13)14)1-2-7(6)9-4-10-8/h1-4H,(H,9,10,12)
SMILES:c1cc2c(cc1N(=O)=O)c(ncn2)O
Synonyms:- 4(1H)-quinazolinone, 6-nitro-
- 4(3H)-Quinazolinone, 6-nitro-
- 6-Nitrochinazolin-4(1H)-on
- 6-Nitroquinazolin-4(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4(3H)-Quinazolinone, 6-nitro-
CAS:Formula:C8H5N3O3Purity:98%Color and Shape:SolidMolecular weight:191.1436Ref: IN-DA006DYZ
1g28.00€5g52.00€10g64.00€25g111.00€50g210.00€100g290.00€250gTo inquire100mg24.00€250mg24.00€6-Nitro-4-quinazolone
CAS:Controlled ProductApplications Intermediate in the preparation of anticancer agents and enzyme inhibitors.
References Alfaro, J., et al.: Drug Metab. Disposition, 37, 2393 (2009), Cha, M., et al.: J. Med. Chem., 52, 6880 (2009),Formula:C8H5N3O3Color and Shape:NeatMolecular weight:191.146-Nitroquinazolin-4(3H)-one
CAS:Formula:C8H5N3O3Purity:97%Color and Shape:SolidMolecular weight:191.146



