CAS 6943-51-7
:2-Propen-1-amine, 2-bromo-
Description:
2-Propen-1-amine, 2-bromo- is an organic compound characterized by its structure, which includes a propenyl group (an alkene) and an amine functional group, along with a bromine atom attached to the second carbon of the propenyl chain. This compound is typically a colorless to pale yellow liquid with a pungent odor, indicative of its amine nature. It is soluble in water and various organic solvents, making it versatile in chemical reactions. The presence of the double bond in the propenyl group allows for potential reactivity in addition reactions, while the amine group can participate in nucleophilic reactions. Additionally, the bromine atom can serve as a leaving group in substitution reactions. Due to its functional groups, 2-propen-1-amine, 2-bromo- can be used in the synthesis of various chemical compounds, including pharmaceuticals and agrochemicals. However, it should be handled with care due to its potential reactivity and the health hazards associated with amines and halogenated compounds.
Formula:C3H6BrN
InChI:InChI=1S/C3H6BrN/c1-3(4)2-5/h1-2,5H2
InChI key:InChIKey=XFSISDMYBCYBKG-UHFFFAOYSA-N
SMILES:C(CN)(Br)=C
Synonyms:- 2-Bromo-2-propen-1-amine
- 2-Bromoallylamine
- 2-Propen-1-Amine, 2-Bromo-
- 3-Amino-2-bromo-1-propene
- Allylamine, 2-bromo-
- NSC 53432
- 2-Bromoprop-2-en-1-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Bromo-allylamine
CAS:2-Bromo-allylamine is an inorganic compound that can be used as a synthetic intermediate for organic synthesis. It has been used to synthesize a variety of compounds, such as pharmaceuticals and agrochemicals. The bromide group is attached to the amine group through an ether bond. Bromoallylation is a chemoenzymatic reaction system that uses 2-bromo-allylamine as an intermediate.
2-Bromo-allylamine can also be synthesized by reacting allyl chloride with bromine or chlorodibromomethane in the presence of catalysts such as copper(II) acetate and sodium methoxide. This reaction has been shown to be able to produce 2-bromo-allylamine in high yield without any side reactions.Formula:C3H6BrNPurity:Min. 95%Molecular weight:135.99 g/mol

