CymitQuimica logo

CAS 69432-64-0

:

2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3,4-dimethoxy-

Description:
2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3,4-dimethoxy- is an organic compound characterized by its unique bicyclic structure, which includes a cycloheptatriene ring system and functional groups that contribute to its reactivity and properties. The presence of a ketone group (1-one) indicates that it has a carbonyl functional group, which can participate in various chemical reactions, such as nucleophilic addition. The hydroxyl group (2-hydroxy) suggests that the compound has alcohol characteristics, potentially influencing its solubility and hydrogen bonding capabilities. Additionally, the dimethoxy groups (3,4-dimethoxy) enhance its electron-donating properties, which can affect its stability and reactivity. This compound may exhibit interesting optical and electronic properties due to its conjugated system, making it of interest in organic synthesis and materials science. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential roles in pharmaceuticals or as a precursor in organic synthesis.
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c1-12-7-5-3-4-6(10)8(11)9(7)13-2/h3-5H,1-2H3,(H,10,11)
Synonyms:
  • 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-3,4-dimethoxy-
  • 3,4-Dimethoxytropolone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 3,4-Dimethoxytropolone

    CAS:
    <p>3,4-Dimethoxytropolone can be isolated from the fermentation broth of Streptoverticillium hadanonense, and it shows activity against both Gram-positive and Gram-negative bacteria.</p>
    Formula:C9H10O4
    Color and Shape:Solid
    Molecular weight:182.173