CAS 6944-34-9
:propanebis(thioamide)
Description:
Propanebis(thioamide), with the CAS number 6944-34-9, is a chemical compound characterized by the presence of two thioamide functional groups attached to a propane backbone. Thioamides are derivatives of amides where the oxygen atom is replaced by a sulfur atom, which imparts distinct chemical properties. This compound typically exhibits a relatively low solubility in water due to its hydrophobic hydrocarbon chain, but it may dissolve in organic solvents. Propanebis(thioamide) can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in coordination chemistry and materials science. Its thioamide groups can also engage in hydrogen bonding and other intermolecular interactions, influencing its physical properties and reactivity. Additionally, compounds containing thioamide functionalities are often studied for their biological activities, including potential roles in pharmaceuticals and agrochemicals. Overall, propanebis(thioamide) serves as a versatile building block in organic synthesis and materials development.
Formula:C3H6N2S2
InChI:InChI=1/C3H6N2S2/c4-2(6)1-3(5)7/h1H2,(H2,4,6)(H2,5,7)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Propanedithioamide
CAS:<p>Propanedithioamide is an organic compound that shows surfactant properties. It has a hydrophobic character and can be used as a coating or stabilizer. Propanedithioamide reacts with metal ions in the environment, such as chloride ions, to form metal-dithiocarbamate complexes that are soluble in organic solvents. The ligand is also able to react with hydroxyl groups on surfaces, which leads to bond cleavage and a new coating. The chemical reactions of propanedithioamide are often used as catalysts for other reactions.</p>Formula:C3H6N2S2Purity:Min. 95%Molecular weight:134.23 g/mol

