CAS 6945-67-1

2-Bromo-4-nitropyridine

Description:

2-Bromo-4-nitropyridine is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a pyridine ring. Its molecular formula is C5H4BrN3O2, indicating that it contains five carbon atoms, four hydrogen atoms, one bromine atom, three nitrogen atoms, and two oxygen atoms. This compound typically appears as a yellow to orange crystalline solid and is known for its moderate solubility in polar organic solvents. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The nitro group enhances its electrophilic properties, allowing it to participate in further chemical reactions, such as nucleophilic substitutions. Additionally, 2-Bromo-4-nitropyridine may exhibit biological activity, which can be of interest in medicinal chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.

Formula: C₅H₃BrN₂O₂

InChI: InChI=1/C5H3BrN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1-3H

SMILES: c1cnc(cc1N(=O)=O)Br

Synonyms:

• 2-Bromo-4-Niropyridine
• 2-BROMO-4-NITROPYRIDINE

2-Bromo-4-nitropyridine

CAS: 6945-67-1

Formula: C₅H₃BrN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 202.9935

Ref: IN-DA003GOW

2-Bromo-4-nitropyridine

CAS: 6945-67-1

Formula: C₅H₃BrN₂O₂

Purity: >95.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 203.00

Ref: 3B-B3523

2-Bromo-4-nitropyridine

CAS: 6945-67-1

2-Bromo-4-nitropyridine

Formula: C₅H₃BrN₂O₂

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 202.99g/mol

Ref: 54-OR3139

2-Bromo-4-nitropyridine

CAS: 6945-67-1

Formula: C₅H₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 202.995

Ref: 10-F067256