CymitQuimica logo

CAS 69455-12-5

:

4-(benzyloxy)-3-bromobenzaldehyde

Description:
4-(Benzyloxy)-3-bromobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and a benzaldehyde functional group. The presence of the benzyloxy group enhances its reactivity and solubility in organic solvents. This compound typically appears as a pale yellow to light brown solid and has a moderate melting point. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to undergo various chemical reactions such as nucleophilic substitutions and electrophilic aromatic substitutions. The bromine atom serves as a useful handle for further functionalization, while the aldehyde group can participate in condensation reactions. Additionally, the compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and proper storage conditions should be maintained to ensure stability.
Formula:C14H11BrO2
InChI:InChI=1/C14H11BrO2/c15-13-8-12(9-16)6-7-14(13)17-10-11-4-2-1-3-5-11/h1-9H,10H2
InChI key:LMAYCCCBNRUZPC-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1ccc(cc1Br)C=O
Synonyms:
  • Benzaldehyde, 3-Bromo-4-(Phenylmethoxy)-
Found 5 products.