CAS 6946-14-1
:3-(acetylamino)-4-methylbenzoic acid
Description:
3-(Acetylamino)-4-methylbenzoic acid, also known by its CAS number 6946-14-1, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an acetylamino group and a methyl group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and ethanol, reflecting its ability to form hydrogen bonds due to the presence of the carboxylic acid and amine functional groups. The acetylamino group contributes to its reactivity, making it a potential candidate for various chemical reactions, including acylation and amidation. The compound's melting point and boiling point can vary based on purity and environmental conditions. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H11NO3
InChI:InChI=1/C10H11NO3/c1-6-3-4-8(10(13)14)5-9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12)(H,13,14)
SMILES:Cc1ccc(cc1N=C(C)O)C(=O)O
Synonyms:- 3-Acetamido-4-methylbenzoic acid
- Benzoic acid, 3-(acetylamino)-4-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Acetamido-4-methylbenzoic acid
CAS:3-Acetamido-4-methylbenzoic acidPurity:98%Molecular weight:193.20g/mol3-Acetamido-4-methylbenzoic acid
CAS:<p>3-Acetamido-4-methylbenzoic acid is a product of organic synthesis. It is an amide compound and is synthesized by the condensation reaction of cyanamide and aniline. 3-Acetamido-4-methylbenzoic acid has been used in the synthesis of medicines such as nilotinib, which is a tyrosine kinase inhibitor that blocks cancer cell growth.</p>Formula:C10H11NO3Purity:Min. 95%Molecular weight:193.2 g/mol


