CAS 6946-15-2
:3-Hydroxy-4-methyl-2-nitrobenzoic acid
Description:
3-Hydroxy-4-methyl-2-nitrobenzoic acid, with the CAS number 6946-15-2, is an organic compound that belongs to the class of benzoic acids. It features a benzoic acid core substituted with a hydroxyl group, a methyl group, and a nitro group, which contribute to its unique chemical properties. This compound typically appears as a solid and is characterized by its aromatic structure, which enhances its stability and reactivity. The presence of the hydroxyl group imparts acidity, while the nitro group can influence its electron-withdrawing properties, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, the methyl group can affect the compound's solubility and steric hindrance. 3-Hydroxy-4-methyl-2-nitrobenzoic acid may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and interactions depend on the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C8H7NO5
InChI:InChI=1S/C8H7NO5/c1-4-2-3-5(8(11)12)6(7(4)10)9(13)14/h2-3,10H,1H3,(H,11,12)
InChI key:InChIKey=HEKGHQKEERXLOI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(O)=O)C=CC(C)=C1O
Synonyms:- 2-Nitro-3-hydroxy-4-methylbenzoic acid
- 3-Hydroxy-4-methyl-2-nitrobenzoic acid
- 3,4-Cresotic acid, 2-nitro-
- NSC 53198
- Benzoic acid, 3-hydroxy-4-methyl-2-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Hydroxy-4-methyl-2-nitrobenzoic acid
CAS:Formula:C8H7NO5Purity:97%Color and Shape:SolidMolecular weight:197.14493-Hydroxy-4-methyl-2-nitrobenzoic acid
CAS:3-Hydroxy-4-methyl-2-nitrobenzoic acidPurity:98%Molecular weight:197.14g/mol3-Hydroxy-4-methyl-2-nitro-benzoic acid
CAS:3-Hydroxy-4-methyl-2-nitrobenzoic acid is an analog of the natural substrate for the enzyme nitroreductase. It can be used in oxidative coupling reactions to generate a covalently bonded product, which is immobilized on sepharose. 3-Hydroxy-4-methyl-2-nitrobenzoic acid has a high affinity for nucleic acids and can be used in biospecific assays. The chromophore of 3-hydroxy-4-methyl-2-nitrobenzoic acid is easily oxidized, leading to its use in nitroreduction reactions in which a nitro group is reduced to an amino group.Purity:Min. 95%



