CAS 6946-22-1
:1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride (1:1)
Description:
1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride (1:1), commonly known as 3-amino phthalic acid hydrochloride, is an organic compound characterized by the presence of both carboxylic acid and amino functional groups attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to the free acid form. The amino group contributes to its basicity, while the carboxylic acid groups can participate in various chemical reactions, including esterification and amidation. This compound is often utilized in the synthesis of dyes, pharmaceuticals, and other organic compounds. Its properties, such as melting point and reactivity, can vary based on the specific conditions and the presence of other functional groups in a reaction. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage in laboratory or industrial settings.
Formula:C8H7NO4·ClH
InChI:InChI=1S/C8H7NO4.ClH/c9-5-3-1-2-4(7(10)11)6(5)8(12)13;/h1-3H,9H2,(H,10,11)(H,12,13);1H
InChI key:InChIKey=ZBZAVEORKXFUQB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C=CC=C1N.Cl
Synonyms:- 1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride
- 1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride (1:1)
- 3-Aminobenzene-1,2-Dicarboxylic Acid Hydrochloride (1:1)
- 3-Aminophthalic Acid Hydrochloride Dihydrate
- Nsc 127008
- Nsc 56716
- Phthalic acid, 3-amino-, hydrochloride
- 3-Aminophthalic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Aminophthalic acid, HCl
CAS:Formula:C8H8ClNO4Purity:95%Color and Shape:SolidMolecular weight:217.6064Pomalidomide Impurity 22 HCl
CAS:Formula:C8H7NO4·HClColor and Shape:Pale Yellow SolidMolecular weight:181.15 36.463-Aminophthalic acid hydrochloride
CAS:3-Aminophthalic acid hydrochloridePurity:98%Molecular weight:217.61g/mol3-Aminophthalic acid hydrochloride
CAS:3-Aminophthalic acid hydrochloride is a diazonium salt that emits light when it reacts with chloride. This compound has been shown to be photophysically active in the presence of human serum, tumor tissue, and micelles. 3-Aminophthalic acid hydrochloride has also been found to be cytotoxic in a number of cancer models. It may also cause death by chemiexcitation of tissues. Furthermore, 3-aminophthalate and acetyl derivatives have shown anticancer activity.
Formula:C8H7NO4HClPurity:80%Color and Shape:PowderMolecular weight:217.61 g/mol3-Aminophthalic acid hydrochloride
CAS:Formula:C8H8ClNO4Purity:98%Color and Shape:SolidMolecular weight:217.613-Aminophthalic Acid Hydrochloride
CAS:Controlled ProductApplications 3-Aminophthalic acid hydrochloride (cas# 6946-22-1) is a useful research chemical.
Formula:C8H7NO4·x(HCl)Color and Shape:NeatMolecular weight:217.6





