CAS 6946-88-9
:4-oxo-4-propoxybutanoic acid
Description:
4-Oxo-4-propoxybutanoic acid, with the CAS number 6946-88-9, is an organic compound characterized by its functional groups, which include a ketone and a carboxylic acid. This compound features a butanoic acid backbone, where a propoxy group is attached to the fourth carbon, and a keto group is present at the same position. The presence of both the ketone and carboxylic acid functionalities contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like this can exhibit polar characteristics due to the carboxylic acid group, which can engage in hydrogen bonding, influencing their solubility in polar solvents. Additionally, the propoxy group can impart hydrophobic properties, affecting the overall solubility and interaction with biological systems. The compound may be utilized in various chemical reactions, including esterification and condensation reactions, making it valuable in the synthesis of more complex molecules. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C7H12O4
InChI:InChI=1/C7H12O4/c1-2-5-11-7(10)4-3-6(8)9/h2-5H2,1H3,(H,8,9)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
