CAS 69477-66-3
:1,2,3,8-tetrahydrocyclopenta[c]pyrido[3,2-a]carbazole
Description:
1,2,3,8-Tetrahydrocyclopenta[c]pyrido[3,2-a]carbazole is a polycyclic aromatic compound characterized by its complex fused ring structure, which includes a pyrido and carbazole moiety. This compound typically exhibits a high degree of stability due to its aromatic character, and it may possess interesting electronic properties, making it a subject of interest in organic electronics and materials science. Its molecular structure suggests potential biological activity, as many compounds with similar frameworks have been studied for their pharmacological properties. The presence of multiple fused rings often contributes to its lipophilicity, influencing its solubility and interaction with biological systems. Additionally, the compound may exhibit fluorescence, which can be useful in various applications, including sensors and imaging. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as temperature and pH. Overall, 1,2,3,8-tetrahydrocyclopenta[c]pyrido[3,2-a]carbazole represents a fascinating area of study within organic chemistry and materials science.
Formula:C18H14N2
InChI:InChI=1/C18H14N2/c1-2-9-15-13(5-1)16-11-6-3-7-12(11)17-14(18(16)20-15)8-4-10-19-17/h1-2,4-5,8-10,20H,3,6-7H2
SMILES:c1ccc2c(c1)c1c3CCCc3c3c(cccn3)c1[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Lys-P-1
CAS:<p>Lys-P-1 is a bioactive chemical.</p>Formula:C18H14N2Color and Shape:SolidMolecular weight:258.323,4-Cyclopentenopyrido[3,2-a]carbazole
CAS:Controlled ProductFormula:C18H14N2Color and Shape:NeatMolecular weight:258.317

