CAS 6948-33-0
:3-Bromo-4-hydroxy-5-methoxycinnamic acid
Description:
3-Bromo-4-hydroxy-5-methoxycinnamic acid is an organic compound characterized by its aromatic structure and functional groups. It features a bromine atom, a hydroxyl group, and a methoxy group attached to a cinnamic acid backbone, which contributes to its reactivity and potential biological activity. The presence of the bromine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. The hydroxyl group provides hydrogen bonding capabilities, while the methoxy group can affect the compound's solubility and stability. This compound may exhibit antioxidant properties and has been studied for its potential applications in pharmaceuticals and agrochemicals. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's unique characteristics may contribute to its use in research related to medicinal chemistry and the development of new therapeutic agents. As with many organic compounds, its behavior in biological systems and environmental impact would depend on various factors, including concentration, exposure duration, and specific conditions.
Formula:C10H8BrO4
InChI:InChI=1/C10H9BrO4/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,14H,1H3,(H,12,13)/p-1/b3-2+
Synonyms:- (2E)-3-(3-Bromo-4-hydroxy-5-methoxyphenyl)acrylic acid
- 2-propenoic acid, 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-, (2E)-
- (2E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid
- (2E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoate
- 3-(3-Bromo-4-hydroxy-5-methoxy-phenyl)-acrylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-4-hydroxy-5-methoxycinnamic acid
CAS:Formula:C10H9BrO4Purity:96%Color and Shape:SolidMolecular weight:273.08013-(3-bromo-4-hydroxy-5-methoxyphenyl)acrylic acid
CAS:3-(3-bromo-4-hydroxy-5-methoxyphenyl)acrylic acidPurity:953-(3-Bromo-4-hydroxy-5-methoxyphenyl)acrylic acid
CAS:Formula:C10H9BrO4Purity:96%Molecular weight:273.0823-(3-Bromo-4-hydroxy-5-methoxyphenyl)acrylic acid
CAS:3-(3-Bromo-4-hydroxy-5-methoxyphenyl)acrylic acid is a polyphenol that can be found in plants and food. It has been shown to have antimicrobial properties against certain bacteria and fungi, such as Staphylococcus aureus, Clostridium perfringens, and Candida albicans. 3-(3-Bromo-4-hydroxy-5-methoxyphenyl)acrylic acid is synthesized by means of the condensation of p-coumaric acid with acrylic acid in the presence of a base catalyst. This compound undergoes biotransformations such as hydroxylation and oxidation to form 3-(3,4′-dihydroxyphenyl)acrylic acid (DHPAA). The compound is also able to react with other phenolic compounds such as cinnamic acid under certain conditions.Formula:C10H9BrO4Purity:Min. 95%Color and Shape:PowderMolecular weight:273.08 g/mol



