CAS 69489-26-5

6-(phenylsulfinyl)-1H-benzimidazol-2-amine

Description:

6-(Phenylsulfinyl)-1H-benzimidazol-2-amine is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a phenylsulfinyl group and an amino group. This compound typically exhibits properties associated with both the benzimidazole and sulfinyl functional groups, such as potential biological activity and solubility in various organic solvents. The presence of the sulfinyl group may impart specific reactivity and stability characteristics, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit properties such as fluorescence or specific interactions with biological targets, which can be explored in pharmacological studies. Its CAS number, 69489-26-5, allows for easy identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, this compound represents a class of heterocyclic compounds that can be valuable in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₁N₃OS

InChI: InChI=1/C13H11N3OS/c14-13-15-11-7-6-10(8-12(11)16-13)18(17)9-4-2-1-3-5-9/h1-8H,(H3,14,15,16)

SMILES: c1ccc(cc1)S(=O)c1ccc2c(c1)[nH]c(=N)[nH]2

Oxfendazole EP Impurity C

CAS: 69489-26-5

Formula: C₁₃H₁₁N₃OS

Molecular weight: 257.31

Ref: ST-EA-CP-O36003

Fenbendazole-Amine Sulfoxide

Controlled Product

CAS: 69489-26-5

Applications Fenbendazole-Amine Sulfoxide is a highly effective inhibitor of the helminth-specific enzyme, fumarate reductas in Ascaris suum. Also, it inhibits the polymerization of tubulin into microtubules in vitro.
References Barrowman, M. M., et al.: Biosci. Rep., 4, 879-883 (1984); Barrowman, M. M., et al.: Biochem. Pharmacol., 33, 3037-3040 (1984);

Formula: C₁₃H₁₁N₃OS

Color and Shape: Neat

Molecular weight: 257.311

Ref: TR-F246760

Fenbendazole-amine sulfoxide

CAS: 69489-26-5

Fenbendazole-amine sulfoxide is a research tool that acts as an activator or ligand for receptor. It is a high-purity reagent for use in pharmacology and cell biology research. Fenbendazole-amine sulfoxide is used to study the function of ion channels and receptors, and its effects on antibody production. Fenbendazole-amine sulfoxide has been shown to inhibit the activity of protein interactions, which may be due to its inhibition of peptide binding or protein synthesis.

Formula: C₁₃H₁₁N₃OS

Purity: Min. 95%

Molecular weight: 257.31 g/mol

Ref: 3D-UCA48926