CAS 6949-76-4

1-[(Methoxycarbonyl)amino]cyclopentanecarboxylic acid

Description:

1-[(Methoxycarbonyl)amino]cyclopentanecarboxylic acid, with the CAS number 6949-76-4, is an organic compound characterized by its cyclopentane structure, which is a five-membered carbon ring. This compound features both a carboxylic acid group and a methoxycarbonylamino group, indicating the presence of an amine functional group attached to a methoxycarbonyl moiety. The presence of these functional groups suggests that the compound may exhibit properties typical of amino acids, such as potential for hydrogen bonding and solubility in polar solvents. Additionally, the methoxycarbonyl group can influence the compound's reactivity and stability, making it a candidate for various chemical reactions, including esterification and amidation. The structural complexity of this compound may also impart unique biological activities, making it of interest in pharmaceutical and biochemical research. Overall, its characteristics are defined by its functional groups, cyclic structure, and potential applications in synthetic chemistry and medicinal chemistry.

Formula: C₈H₁₃NO₄

InChI: InChI=1/C8H13NO4/c1-13-7(12)9-8(6(10)11)4-2-3-5-8/h2-5H2,1H3,(H,9,12)(H,10,11)

InChI key: InChIKey=YRFODXIYZFKYQK-UHFFFAOYSA-N

SMILES: N(C(OC)=O)C1(C(O)=O)CCCC1

Synonyms:

• Cyclopentanecarboxylic acid, 1-[(methoxycarbonyl)amino]-
• NSC 22848
• 1-[(Methoxycarbonyl)amino]cyclopentanecarboxylic acid
• 1-[(Methoxycarbonyl)amino]cyclopentane-1-carboxylic acid
• Cyclopentanecarboxylicacid, 1-[(methoxycarbonyl)amino]-

1-[(Methoxycarbonyl)amino]cyclopentane-1-carboxylic acid

CAS: 6949-76-4

Versatile small molecule scaffold

Formula: C₈H₁₃NO₄

Purity: Min. 95%

Molecular weight: 187.19 g/mol

Ref: 3D-GAA94976