CAS 695-02-3

3-Bromotricyclo[2.2.1.0(2,6)]heptane

Description:

3-Bromotricyclo[2.2.1.0(2,6)]heptane is a bicyclic organic compound characterized by its unique tricyclic structure, which consists of three interconnected rings. The presence of a bromine atom at the 3-position of the tricyclic framework significantly influences its chemical properties, including reactivity and polarity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis, particularly in the development of more complex molecules due to its reactive bromine substituent. The compound's molecular formula reflects its composition, and its structure contributes to its stability and reactivity patterns. As with many halogenated compounds, 3-bromotricyclo[2.2.1.0(2,6)]heptane may exhibit interesting behavior in nucleophilic substitution reactions. Safety precautions are essential when handling this compound, as brominated compounds can pose health risks and environmental concerns. Overall, its unique structure and reactivity make it a subject of interest in organic chemistry research.

Formula: C₇H₉Br

InChI: InChI=1/C7H9Br/c8-7-3-1-4-5(2-3)6(4)7/h3-7H,1-2H2

Synonyms:

• Nortricyclyl Bromide
• 3-bromotricyclo[2.2.1.0~2,6~]heptane

3-Bromotricyclo[2.2.1.0,2,6]heptane

CAS: 695-02-3

3-Bromotricyclo[2.2.1.0,2,6]heptane is a biomolecule and azabicyclic compound with molecular formula C8H14Br and molecular weight of 152.19 g/mol. It has been shown to react through nucleophilic attack at the carbonyl carbon to produce an intermediate that tautomerizes to the corresponding ketone in a cycloaddition reaction with acetaldehyde or xylene. The deuterated derivative of this compound has been synthesized using deuteration techniques and can be used for studies on the mechanism of substitution reactions of nucleophiles such as chloride or butyltin compounds. This biomolecule also reacts with alkoxides at temperatures greater than 0°C to form ethyl 2-bromo-3-methylhexanoate, which can be used as a starting material for the synthesis of biphenyls by Friedel-Crafts

Formula: C₇H₉Br

Purity: Min. 95%

Molecular weight: 173.05 g/mol

Ref: 3D-AAA69502