CAS 695-15-8
:1,4-dimethylpiperidine
Description:
1,4-Dimethylpiperidine is a cyclic organic compound characterized by a piperidine ring with two methyl groups attached to the first and fourth carbon atoms. Its molecular formula is C7H15N, indicating the presence of seven carbon atoms, fifteen hydrogen atoms, and one nitrogen atom. This compound is a colorless to pale yellow liquid at room temperature and has a distinctive amine-like odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. 1,4-Dimethylpiperidine is primarily used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It exhibits basic properties typical of amines, allowing it to participate in various chemical reactions, including alkylation and acylation. Additionally, it can act as a ligand in coordination chemistry. Safety considerations include its potential to cause irritation upon contact with skin or eyes, and appropriate handling measures should be taken to minimize exposure.
Formula:C7H15N
InChI:InChI=1/C7H15N/c1-7-3-5-8(2)6-4-7/h7H,3-6H2,1-2H3
SMILES:CC1CCN(C)CC1
Synonyms:- Piperidine, 1,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
