CAS 695-95-4
:methyl 3-oxocyclobutanecarboxylate
Description:
Methyl 3-oxocyclobutanecarboxylate, with the CAS number 695-95-4, is an organic compound characterized by its cyclobutane ring structure, which is a four-membered cyclic alkane. This compound features a ketone functional group (the 3-oxo group) and an ester functional group (the methyl ester), contributing to its reactivity and versatility in organic synthesis. It is typically a colorless to pale yellow liquid with a pleasant odor, and it is soluble in organic solvents such as ethanol and ether. The presence of both the carbonyl and ester functionalities allows for various chemical reactions, including nucleophilic additions and condensation reactions. Methyl 3-oxocyclobutanecarboxylate can be used as an intermediate in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Its unique structure and functional groups make it a valuable compound in synthetic organic chemistry, particularly in the development of new materials and compounds with potential biological activity.
Formula:C6H8O3
InChI:InChI=1/C6H8O3/c1-9-6(8)4-2-5(7)3-4/h4H,2-3H2,1H3
SMILES:COC(=O)C1CC(=O)C1
Synonyms:- Methyl 3-oxo-cyclobutanecarboxylate
- Methyl 3-oxocyclobutane-1-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Methyl 3-oxocyclobutanecarboxylate, 97%
CAS:Methyl 3-oxocyclobutanecarboxylate can be used as an intermediate for the synthesis of various pharmaceutical compounds. It is used for the preparation of novel imidazobenzazepine derivatives as dual H1/5-HT2A antagonists for the treatment of sleep disorders. This Thermo Scientific Chemicals brand p
Formula:C6H8O3Purity:97%Molecular weight:128.12Methyl 3-oxocyclobutanecarboxylate
CAS:Formula:C6H8O3Purity:97%Color and Shape:LiquidMolecular weight:128.1259Methyl 3-Oxocyclobutanecarboxylate
CAS:Formula:C6H8O3Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:128.13Methyl 3-oxocyclobutanecarboxylate
CAS:Methyl 3-oxocyclobutanecarboxylate
Formula:C6H8O3Purity:95%Color and Shape: colourless liquidMolecular weight:128.13g/molMethyl 3-Oxocyclobutanecarboxylate
CAS:Formula:C6H8O3Purity:97%Color and Shape:LiquidMolecular weight:128.127






