CAS 69500-53-4
:4-{4-[(2S)-oxiran-2-ylmethoxy]-1,2,5-thiadiazol-3-yl}morpholine
Description:
4-{4-[(2S)-oxiran-2-ylmethoxy]-1,2,5-thiadiazol-3-yl}morpholine, with the CAS number 69500-53-4, is a chemical compound characterized by its unique structural features, including a morpholine ring and a thiadiazole moiety. The presence of the epoxide group (oxirane) indicates potential reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit biological activity due to its complex structure, which can interact with various biological targets. The thiadiazole ring contributes to its potential as a pharmacophore, while the morpholine component can enhance solubility and bioavailability. Additionally, the compound's stereochemistry, particularly the (2S) configuration of the oxirane, may influence its interaction with biological systems. Overall, this substance is of interest in medicinal chemistry and may be explored for applications in drug development or as a biochemical probe, although specific biological activities and applications would require further investigation and validation through experimental studies.
Formula:C9H13N3O3S
InChI:InChI=1/C9H13N3O3S/c1-3-13-4-2-12(1)8-9(11-16-10-8)15-6-7-5-14-7/h7H,1-6H2/t7-/m0/s1
SMILES:C1COCCN1c1c(nsn1)OC[C@@H]1CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(S)-4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine
CAS:Controlled ProductApplications (S)-4-[4-(Oxiranylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine (cas# 69500-53-4) is a compound useful in organic synthesis.
Formula:C9H13N3O3SColor and Shape:Off-WhiteMolecular weight:243.28


