CAS 69503-94-2

3,4,6-Tri-O-Acetyl-2-Deoxy-D-glucopyranose

Description:

3,4,6-Tri-O-Acetyl-2-Deoxy-D-glucopyranose is a derivative of D-glucose, specifically modified at the hydroxyl groups at positions 3, 4, and 6 with acetyl groups, while the hydroxyl group at position 2 is replaced by a hydrogen atom, making it a deoxy sugar. This compound is typically a white to off-white crystalline solid, soluble in organic solvents such as chloroform and methanol, but less soluble in water due to its acetylation. The acetyl groups enhance its stability and lipophilicity, making it useful in various chemical reactions and applications, particularly in carbohydrate chemistry and synthesis. It can serve as an intermediate in the synthesis of more complex carbohydrates or glycosides. The presence of acetyl groups also influences its reactivity, allowing for selective deacetylation or further functionalization. As a chemical substance, it is important to handle it with care, following appropriate safety protocols, as with any chemical compound.

Formula: C₁₂H₁₈O₈

InChI: InChI=1/C12H18O8/c1-6(13)17-5-10-12(19-8(3)15)9(18-7(2)14)4-11(16)20-10/h9-12,16H,4-5H2,1-3H3/t9-,10-,11u,12+/m1/s1

3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose

CAS: 69503-94-2

Formula: C₁₂H₁₈O₈

Purity: 98.0%

Molecular weight: 290.2665

Ref: IN-DA003IF8

(2R,3S,4R)-2-(Acetoxymethyl)-6-Hydroxytetrahydro-2H-Pyran-3,4-Diyl Diacetate

CAS: 69503-94-2

(2R,3S,4R)-2-(Acetoxymethyl)-6-Hydroxytetrahydro-2H-Pyran-3,4-Diyl Diacetate

Purity: 97%

Molecular weight: 290.27g/mol

Ref: 54-OR1026092

3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose

CAS: 69503-94-2

Formula: C₁₂H₁₈O₈

Purity: ≥ 95.0%

Color and Shape: White to off-white powder

Molecular weight: 290.27

Ref: 7W-GC7986

3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose

CAS: 69503-94-2

3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose is a naturally occurring carbohydrate that is found in many plants. It can be used as a chiral building block for the synthesis of other compounds, such as atropisomers. The compound has two different stereoisomers that are related by rotation around the central C2' carbon. This stereoisomerism can be explained by the structural features of the molecule, including a phenyl ring and an atropisomeric relationship between the three hydroxyl groups on the glucose moiety. 3,4,6-Tri-O-acetyl-2-deoxyglucopyranose is stable to heat and acid treatment, but is hydrolyzed by esterases.

Formula: C₁₂H₁₈O₈

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 290.27 g/mol

Ref: 3D-MT07035

3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose

CAS: 69503-94-2

Formula: C₁₂H₁₈O₈

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 290.27

Ref: 3B-T1931