CAS 69503-94-2: 3,4,6-Tri-O-Acetyl-2-Deoxy-D-glucopyranose
Description:3,4,6-Tri-O-Acetyl-2-Deoxy-D-glucopyranose is a derivative of D-glucose, specifically modified at the hydroxyl groups at positions 3, 4, and 6 with acetyl groups, while the hydroxyl group at position 2 is replaced by a hydrogen atom, making it a deoxy sugar. This compound is typically a white to off-white crystalline solid, soluble in organic solvents such as chloroform and methanol, but less soluble in water due to its acetylation. The acetyl groups enhance its stability and lipophilicity, making it useful in various chemical reactions and applications, particularly in carbohydrate chemistry and synthesis. It can serve as an intermediate in the synthesis of more complex carbohydrates or glycosides. The presence of acetyl groups also influences its reactivity, allowing for selective deacetylation or further functionalization. As a chemical substance, it is important to handle it with care, following appropriate safety protocols, as with any chemical compound.
Formula:C12H18O8
InChI:InChI=1/C12H18O8/c1-6(13)17-5-10-12(19-8(3)15)9(18-7(2)14)4-11(16)20-10/h9-12,16H,4-5H2,1-3H3/t9-,10-,11u,12+/m1/s1
