CAS 695145-47-2

4-(dimethylaminomethyl)piperidin-4-ol

Description:

4-(Dimethylaminomethyl)piperidin-4-ol, with the CAS number 695145-47-2, is a chemical compound characterized by its piperidine structure, which includes a hydroxyl group and a dimethylaminomethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. The presence of the dimethylamino group contributes to its basicity and can influence its solubility in polar solvents. Additionally, the hydroxyl group can participate in hydrogen bonding, enhancing its reactivity and interactions with biological targets. Safety data sheets indicate that it should be handled with care, as it may pose health risks upon exposure. Overall, 4-(dimethylaminomethyl)piperidin-4-ol is a versatile compound with significant relevance in chemical research and development.

Formula: C₈H₁₈N₂O

InChI: InChI=1/C8H18N2O/c1-10(2)7-8(11)3-5-9-6-4-8/h9,11H,3-7H2,1-2H3

SMILES: CN(C)CC1(CCNCC1)O

4-[(dimethylamino)methyl]-4-piperidinol

CAS: 695145-47-2

Formula: C₈H₁₈N₂O

Purity: 95.0%

Molecular weight: 158.245

Ref: 10-F311307