CAS 69519-51-3
:1,3-Di-n-octyltetramethyldisilazane
Description:
1,3-Di-n-octyltetramethyldisilazane is a chemical compound characterized by its unique structure, which includes a silazane framework. This compound features two n-octyl groups and four methyl groups attached to silicon atoms, contributing to its hydrophobic properties. It is typically used as a surface modifier and a coupling agent in various applications, including coatings, adhesives, and sealants, due to its ability to enhance adhesion and improve water repellency. The presence of the long n-octyl chains imparts significant lipophilicity, making it suitable for use in organic solvents and non-polar environments. Additionally, the silazane structure provides thermal stability and resistance to moisture, which can be advantageous in industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1,3-Di-n-octyltetramethyldisilazane is valued for its functional properties in enhancing material performance in various chemical and industrial processes.
Formula:C20H47NSi2
InChI:InChI=1/C20H47NSi2/c1-7-9-11-13-15-17-19-22(3,4)21-23(5,6)20-18-16-14-12-10-8-2/h21H,7-20H2,1-6H3
SMILES:CCCCCCCC[Si](C)(C)N[Si](C)(C)CCCCCCCC
Synonyms:- N-[dimethyl(octyl)silyl]-1,1-dimethyl-1-octylsilanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Di-n-octyltetramethyldisilazane
CAS:<p>S07700 - 1,3-Di-n-octyltetramethyldisilazane</p>Formula:C20H47NSi2Color and Shape:ClearMolecular weight:357.773
