CymitQuimica logo

CAS 6952-32-5

:

2-(3-hydroxybutyl)phenol

Description:
2-(3-Hydroxybutyl)phenol, with the CAS number 6952-32-5, is an organic compound characterized by a phenolic structure substituted with a hydroxybutyl group. This compound typically appears as a viscous liquid or solid, depending on temperature and purity. It features a hydroxyl (-OH) group, which contributes to its solubility in polar solvents and enhances its reactivity in various chemical processes. The presence of the hydroxybutyl group provides additional hydrophilicity and can influence the compound's physical properties, such as boiling point and melting point. 2-(3-Hydroxybutyl)phenol is often utilized in the synthesis of polymers, surfactants, and as an intermediate in organic synthesis. Its phenolic nature allows it to participate in hydrogen bonding, making it useful in applications requiring adhesion or stabilization. Additionally, the compound may exhibit antioxidant properties, which can be beneficial in various industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c1-8(11)6-7-9-4-2-3-5-10(9)12/h2-5,8,11-12H,6-7H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.