CAS 6952-35-8

6-(4-Hydroxyphenyl)hexanoic Acid

Description:

6-(4-Hydroxyphenyl)hexanoic acid, also known by its CAS number 6952-35-8, is an organic compound characterized by its carboxylic acid functional group and a hydroxyphenyl substituent. This compound features a hexanoic acid backbone, which consists of a six-carbon chain, with a hydroxyl group (-OH) attached to a phenyl ring at the fourth carbon position. The presence of the hydroxy group contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and reactivity. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug formulation and as a building block for synthesizing more complex molecules. Its physical properties, such as melting point and solubility, can vary based on environmental conditions and the presence of other substances. Overall, 6-(4-Hydroxyphenyl)hexanoic acid represents a versatile compound with significant implications in chemical research and application.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c13-11-8-6-10(7-9-11)4-2-1-3-5-12(14)15/h6-9,13H,1-5H2,(H,14,15)

SMILES: C(CCc1ccc(cc1)O)CCC(=O)O

6-(4-Hydroxyphenyl)hexanoic acid

CAS: 6952-35-8

Formula: C₁₂H₁₆O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.2536

Ref: IN-DA00FDXE

6-(4-Hydroxyphenyl)hexanoic acid

CAS: 6952-35-8

6-(4-Hydroxyphenyl)hexanoic acid

Purity: 97%

Molecular weight: 208.25g/mol

Ref: 54-OR78195

6-(4-Hydroxyphenyl)hexanoic acid

CAS: 6952-35-8

Purity: 97%

Molecular weight: 208.2570038

Ref: 10-F670284

6-(4-Hydroxyphenyl)hexanoic Acid

Controlled Product

CAS: 6952-35-8

Formula: C₁₂H₁₆O₃

Color and Shape: Neat

Molecular weight: 208.25

Ref: TR-H949275