CAS 6952-68-7
:[1,2,4]Triazolo[4,3-a]pyridine-3-thiol
Description:
[1,2,4]Triazolo[4,3-a]pyridine-3-thiol is a heterocyclic compound characterized by a fused triazole and pyridine ring system, with a thiol (-SH) functional group at the 3-position of the pyridine moiety. This compound typically exhibits properties associated with both triazole and pyridine derivatives, such as potential biological activity and the ability to form coordination complexes with metal ions due to the presence of the thiol group. The thiol functionality can participate in various chemical reactions, including oxidation and nucleophilic substitution, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit interesting pharmacological properties, including antimicrobial and anti-inflammatory activities, which are common in thiol-containing heterocycles. Its solubility and stability can vary depending on the solvent and environmental conditions, and it may be sensitive to air and moisture. Overall, [1,2,4]Triazolo[4,3-a]pyridine-3-thiol is a compound of interest in medicinal chemistry and materials science.
Formula:C6H5N3S
InChI:InChI=1/C6H5N3S/c10-6-8-7-5-3-1-2-4-9(5)6/h1-4H,(H,8,10)
SMILES:c1ccn2c(c1)nnc2S
Synonyms:- (1,2,4)Triazolo(4,3-a)pyridine-3(2H)-thione
- Nsc 70716
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2,4-Triazolo[4,3-a]pyridine-3-thiol, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5N3SPurity:96%Color and Shape:White to pale cream, PowderMolecular weight:151.19[1,2,4]Triazolo[4,3-a]pyridine-3-thiol
CAS:Formula:C6H5N3SPurity:95%Color and Shape:SolidMolecular weight:151.1890[1,2,4]Triazolo[4,3-a]pyridine-3-thiol
CAS:[1,2,4]Triazolo[4,3-a]pyridine-3-thiolPurity:≥95%Color and Shape:Pale Yellow SolidMolecular weight:151.19g/mol[1,2,4]Triazolo[4,3-a]pyridine-3-thiol
CAS:Formula:C6H5N3SPurity:95%Color and Shape:Solid, Pale yellow crystalline powderMolecular weight:151.19[1,2,4]Triazolo[4,3-a]pyridine-3-thiol
CAS:Controlled ProductStability Air Sensitive
Applications [1,2,4]Triazolo[4,3-a]pyridine-3-thiol (cas# 6952-68-7) is a useful research chemical.Formula:C6H5N3SColor and Shape:NeatMolecular weight:151.19




