CymitQuimica logo

CAS 69526-89-2

:

3-Formyl-4-methylbenzoic acid

Description:
3-Formyl-4-methylbenzoic acid, with the CAS number 69526-89-2, is an aromatic carboxylic acid characterized by the presence of both an aldehyde and a carboxylic acid functional group on a benzene ring. The compound features a methyl group at the para position relative to the carboxylic acid group and an aldehyde group at the meta position. This structural arrangement contributes to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound can participate in various chemical reactions, including condensation and esterification, making it useful in organic synthesis and as an intermediate in the production of more complex molecules. Additionally, its functional groups can engage in hydrogen bonding, influencing its physical properties such as melting point and boiling point. Overall, 3-Formyl-4-methylbenzoic acid is a valuable compound in both academic research and industrial applications.
Formula:C9H8O3
InChI:InChI=1S/C9H8O3/c1-6-2-3-7(9(11)12)4-8(6)5-10/h2-5H,1H3,(H,11,12)
InChI key:InChIKey=REPNRLBITGLALU-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(C(O)=O)=CC=C1C
Synonyms:
  • 3-Formyl-4-methylbenzoic acid
  • Benzoic acid, 3-formyl-4-methyl-
Found 6 products.