CAS 6953-72-6
:methyl 2,3-di-O-benzoyl-4,6-O-benzylidenehexopyranoside
Description:
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidenehexopyranoside, with the CAS number 6953-72-6, is a glycoside derivative characterized by its complex structure, which includes multiple aromatic benzoyl and benzylidene groups. This compound is typically derived from hexopyranose sugars, exhibiting properties that are influenced by the presence of these substituents. The benzoyl groups enhance its lipophilicity and stability, while the benzylidene moiety contributes to its reactivity and potential applications in organic synthesis. Methyl 2,3-di-O-benzoyl-4,6-O-benzylidenehexopyranoside is often utilized in carbohydrate chemistry, particularly in the synthesis of more complex carbohydrate derivatives and as an intermediate in the preparation of various bioactive compounds. Its solubility in organic solvents and stability under standard laboratory conditions make it a valuable compound for research and development in both synthetic and medicinal chemistry. Additionally, the presence of multiple functional groups allows for further chemical modifications, expanding its utility in various chemical applications.
Formula:C28H26O8
InChI:InChI=1/C28H26O8/c1-31-28-24(35-26(30)19-13-7-3-8-14-19)23(34-25(29)18-11-5-2-6-12-18)22-21(33-28)17-32-27(36-22)20-15-9-4-10-16-20/h2-16,21-24,27-28H,17H2,1H3/t21-,22+,23-,24-,27?,28-/m0/s1
Synonyms:- 8-(Benzoyloxy)-6-Methoxy-2-Phenylhexahydropyrano[3,2-D][1,3]Dioxin-7-Yl Benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-galactopyranoside
CAS:<p>Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-galactopyranoside is a custom synthesis by our company. It is an oligosaccharide that is modified with methyl groups and fluorine atoms. This product has a CAS number of 6953-72-6 and can be synthesized in high purity. It is also a monosaccharide sugar that can be obtained through the modification of other carbohydrates.</p>Formula:C28H26O8Purity:Min. 95%Molecular weight:490.51 g/mol

